Produkt-Name |
4-Nitrophenoxyacetic acid hydrazide |
Synonyme |
Acetic acid, (4-nitrophenoxy)-, hydrazide; 2-(4-nitrophenoxy)acetohydrazide |
Molekulare Formel |
C8H9N3O4 |
Molecular Weight |
211.1748 |
InChI |
InChI=1/C8H9N3O4/c9-10-8(12)5-15-7-3-1-6(2-4-7)11(13)14/h1-4H,5,9H2,(H,10,12) |
CAS Registry Number |
75129-74-7 |
Molecular Structure |
|
Dichte |
1.394g/cm3 |
Siedepunkt |
511.9°C at 760 mmHg |
Brechungsindex |
1.592 |
Flammpunkt |
263.4°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|