Nome del prodotto |
4-Nitrophenoxyacetic acid hydrazide |
Sinonimi |
Acetic acid, (4-nitrophenoxy)-, hydrazide; 2-(4-nitrophenoxy)acetohydrazide |
Formula molecolare |
C8H9N3O4 |
Peso Molecolare |
211.1748 |
InChI |
InChI=1/C8H9N3O4/c9-10-8(12)5-15-7-3-1-6(2-4-7)11(13)14/h1-4H,5,9H2,(H,10,12) |
Numero CAS |
75129-74-7 |
Struttura molecolare |
|
Densità |
1.394g/cm3 |
Punto di ebollizione |
511.9°C at 760 mmHg |
Indice di rifrazione |
1.592 |
Punto d'infiammabilità |
263.4°C |
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|