product Name |
2-(Difluoromethylthio)benzoic acid |
Synonyms |
2-[(difluoromethyl)sulfanyl]benzoate; 2-[(difluoromethyl)sulfanyl]benzoic acid; 2-[(difluoromethyl)sulfanyl]benzoyl chloride |
Molecular Formula |
C8H5ClF2OS |
Molecular Weight |
222.6395 |
InChI |
InChI=1/C8H5ClF2OS/c9-7(12)5-3-1-2-4-6(5)13-8(10)11/h1-4,8H |
CAS Registry Number |
79676-56-5 |
Molecular Structure |
|
Density |
1.42g/cm3 |
Boiling point |
236.2°C at 760 mmHg |
Refractive index |
1.541 |
Flash point |
96.6°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|