Nama produk |
2-(Difluoromethylthio)benzoic acid |
Sinonim |
2-[(difluoromethyl)sulfanyl]benzoate; 2-[(difluoromethyl)sulfanyl]benzoic acid; 2-[(difluoromethyl)sulfanyl]benzoyl chloride |
MF |
C8H5ClF2OS |
Berat Molekul |
222.6395 |
InChI |
InChI=1/C8H5ClF2OS/c9-7(12)5-3-1-2-4-6(5)13-8(10)11/h1-4,8H |
CAS NO |
79676-56-5 |
Struktur Molekul |
|
Kepadatan |
1.42g/cm3 |
Titik didih |
236.2°C at 760 mmHg |
Indeks bias |
1.541 |
Titik nyala |
96.6°C |
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|