product Name |
Methyl 3-methylthiophene-2-carboxylate |
Synonyms |
3-Methylthiophene-2-carboxylic acid methyl ester; Methyl-3-methylthiophene-2-carboxylate |
Molecular Formula |
C7H8O2S |
Molecular Weight |
156.2022 |
InChI |
InChI=1/C7H8O2S/c1-5-3-4-10-6(5)7(8)9-2/h3-4H,1-2H3 |
CAS Registry Number |
81452-54-2 |
Molecular Structure |
|
Density |
1.173g/cm3 |
Boiling point |
211°C at 760 mmHg |
Refractive index |
1.531 |
Flash point |
81.4°C |
Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|