उत्पाद का नाम |
Methyl 3-methylthiophene-2-carboxylate |
समानार्थी |
3-Methylthiophene-2-carboxylic acid methyl ester; Methyl-3-methylthiophene-2-carboxylate |
आणविक फार्मूला |
C7H8O2S |
आण्विक वजन |
156.2022 |
InChI |
InChI=1/C7H8O2S/c1-5-3-4-10-6(5)7(8)9-2/h3-4H,1-2H3 |
कैस रजिस्टी संख्या |
81452-54-2 |
आणविक संरचना |
|
घनत्व |
1.173g/cm3 |
उबलने का समय |
211°C at 760 mmHg |
अपवर्तक सूचकांक |
1.531 |
फ्लैश प्वाइंट |
81.4°C |
सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|