Produkt-Name |
Cyclohexyl methyl ketone |
Synonyme |
Acetylcyclohexane~Hexahydroacetophenone~Methyl cyclohexyl ketone; Acetylcyclohexane; 1-cyclohexylethanone; 1-CYCLOHEXYLETHAN-1-ONE |
Molekulare Formel |
C8H14O |
Molecular Weight |
126.1962 |
InChI |
InChI=1/C8H14O/c1-7(9)8-5-3-2-4-6-8/h8H,2-6H2,1H3 |
CAS Registry Number |
823-76-7 |
EINECS |
212-517-0 |
Molecular Structure |
|
Dichte |
0.916g/cm3 |
Siedepunkt |
181.5°C at 760 mmHg |
Brechungsindex |
1.448 |
Flammpunkt |
61.4°C |
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|