Nama produk |
Cyclohexyl methyl ketone |
Sinonim |
Acetylcyclohexane~Hexahydroacetophenone~Methyl cyclohexyl ketone; Acetylcyclohexane; 1-cyclohexylethanone; 1-CYCLOHEXYLETHAN-1-ONE |
MF |
C8H14O |
Berat Molekul |
126.1962 |
InChI |
InChI=1/C8H14O/c1-7(9)8-5-3-2-4-6-8/h8H,2-6H2,1H3 |
CAS NO |
823-76-7 |
EINECS |
212-517-0 |
Struktur Molekul |
|
Kepadatan |
0.916g/cm3 |
Titik didih |
181.5°C at 760 mmHg |
Indeks bias |
1.448 |
Titik nyala |
61.4°C |
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|