product Name |
2-hydroxyimino-2-phenylacetonitrile, mixture |
Synonyms |
2-Hydroxyimino-2-phenylacetonitrile; Benzoyl cyanide oxime~Phenylglyoxylonitrile oxime; (hydroxyimino)(phenyl)acetonitrile; (2E)-(hydroxyimino)(phenyl)ethanenitrile |
Molecular Formula |
C8H6N2O |
Molecular Weight |
146.146 |
InChI |
InChI=1/C8H6N2O/c9-6-8(10-11)7-4-2-1-3-5-7/h1-5,11H/b10-8- |
CAS Registry Number |
825-52-5 |
EINECS |
212-546-9 |
Molecular Structure |
|
Density |
1.11g/cm3 |
Melting point |
128-130℃ |
Boiling point |
293.3°C at 760 mmHg |
Refractive index |
1.562 |
Flash point |
131.2°C |
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|