Nama produk |
2-hydroxyimino-2-phenylacetonitrile, mixture |
Sinonim |
2-Hydroxyimino-2-phenylacetonitrile; Benzoyl cyanide oxime~Phenylglyoxylonitrile oxime; (hydroxyimino)(phenyl)acetonitrile; (2E)-(hydroxyimino)(phenyl)ethanenitrile |
MF |
C8H6N2O |
Berat Molekul |
146.146 |
InChI |
InChI=1/C8H6N2O/c9-6-8(10-11)7-4-2-1-3-5-7/h1-5,11H/b10-8- |
CAS NO |
825-52-5 |
EINECS |
212-546-9 |
Struktur Molekul |
|
Kepadatan |
1.11g/cm3 |
Titik lebur |
128-130℃ |
Titik didih |
293.3°C at 760 mmHg |
Indeks bias |
1.562 |
Titik nyala |
131.2°C |
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|