product Name |
Benzyl phenyl sulfide |
Synonyms |
Benzyl phenyl sulphide; Benzyl phenyl sylphide; (benzylsulfanyl)benzene |
Molecular Formula |
C13H12S |
Molecular Weight |
200.2994 |
InChI |
InChI=1/C13H12S/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13/h1-10H,11H2 |
CAS Registry Number |
831-91-4 |
EINECS |
212-612-7 |
Molecular Structure |
|
Density |
1.1g/cm3 |
Melting point |
40-43℃ |
Boiling point |
321.1°C at 760 mmHg |
Refractive index |
1.626 |
Flash point |
138.9°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|