Nome del prodotto |
Benzyl phenyl sulfide |
Sinonimi |
Benzyl phenyl sulphide; Benzyl phenyl sylphide; (benzylsulfanyl)benzene |
Formula molecolare |
C13H12S |
Peso Molecolare |
200.2994 |
InChI |
InChI=1/C13H12S/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13/h1-10H,11H2 |
Numero CAS |
831-91-4 |
EINECS |
212-612-7 |
Struttura molecolare |
|
Densità |
1.1g/cm3 |
Punto di fusione |
40-43℃ |
Punto di ebollizione |
321.1°C at 760 mmHg |
Indice di rifrazione |
1.626 |
Punto d'infiammabilità |
138.9°C |
Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|