termék neve |
2-Amino-1-propene-1,1,3-tricarbonitrile |
Szinonimák |
2-aminoprop-1-ene-1,1,3-tricarbonitrile |
MF |
C6H4N4 |
Molekulatömeg |
132.1228 |
InChI |
InChI=1/C6H4N4/c7-2-1-6(10)5(3-8)4-9/h5,10H,1H2/b10-6+ |
CAS-szám |
868-54-2 |
EINECS |
212-777-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.13g/cm3 |
Olvadáspont |
171-173℃ |
Forráspont |
454.9°C at 760 mmHg |
Törésmutató |
1.565 |
Gyulladáspont |
228.9°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|