produktnavn |
2-Amino-1-propene-1,1,3-tricarbonitrile |
Synonymer |
2-aminoprop-1-ene-1,1,3-tricarbonitrile |
Molekylær Formel |
C6H4N4 |
Molekylvekt |
132.1228 |
InChI |
InChI=1/C6H4N4/c7-2-1-6(10)5(3-8)4-9/h5,10H,1H2/b10-6+ |
CAS-nummer |
868-54-2 |
EINECS |
212-777-5 |
Molecular Structure |
|
Tetthet |
1.13g/cm3 |
Smeltepunkt |
171-173℃ |
Kokepunkt |
454.9°C at 760 mmHg |
Brytningsindeks |
1.565 |
Flammepunktet |
228.9°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|