نام محصول |
4-Acetoxybenzaldehyde |
مترادف |
4-Formylphenyl acetate |
میدان مغناطیسی |
C9H8O3 |
وزن مولکولی |
164.158 |
InChI |
InChI=1/C9H8O3/c1-7(11)12-9-4-2-8(6-10)3-5-9/h2-6H,1H3 |
شماره سیایاس |
878-00-2 |
تعداد کمیسیون اروپایی |
212-898-3 |
ساختار مولکولی |
|
تراکم |
1.183g/cm3 |
نقطه غلیان |
275°C at 760 mmHg |
ضریب شکست |
1.552 |
نقطه اشتعال |
119.4°C |
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|