Nama produk |
4-Acetoxybenzaldehyde |
Sinonim |
4-Formylphenyl acetate |
MF |
C9H8O3 |
Berat Molekul |
164.158 |
InChI |
InChI=1/C9H8O3/c1-7(11)12-9-4-2-8(6-10)3-5-9/h2-6H,1H3 |
CAS NO |
878-00-2 |
EINECS |
212-898-3 |
Struktur Molekul |
|
Kepadatan |
1.183g/cm3 |
Titik didih |
275°C at 760 mmHg |
Indeks bias |
1.552 |
Titik nyala |
119.4°C |
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|