product Name |
2-Hydroxybenzeneboronic acid |
Synonyms |
2-Boronophenol; 2-Hydroxyphenylboronic acid |
Molecular Formula |
C6H7BO3 |
Molecular Weight |
137.929 |
InChI |
InChI=1/C6H7BO3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8-10H |
CAS Registry Number |
89466-08-0 |
Molecular Structure |
|
Density |
1.32g/cm3 |
Boiling point |
327.3°C at 760 mmHg |
Refractive index |
1.582 |
Flash point |
151.7°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|