Naam product |
2-Hydroxybenzeneboronic acid |
Synoniemen |
2-Boronophenol; 2-Hydroxyphenylboronic acid |
MF |
C6H7BO3 |
Molecuulgewicht |
137.929 |
InChI |
InChI=1/C6H7BO3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8-10H |
CAS-nummer |
89466-08-0 |
Moleculaire Structuur |
|
Dichtheid |
1.32g/cm3 |
Kookpunt |
327.3°C at 760 mmHg |
Brekingsindex |
1.582 |
Vlampunt |
151.7°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|