Produkt-Name |
2-Ethylbenzeneboronic acid |
Synonyme |
2-Ethylphenylboronic acid; RNase A |
Molekulare Formel |
C8H11BO2 |
Molecular Weight |
149.9827 |
InChI |
InChI=1/C8H11BO2/c1-2-7-5-3-4-6-8(7)9(10)11/h3-6,10-11H,2H2,1H3 |
CAS Registry Number |
90002-36-1 |
Molecular Structure |
|
Dichte |
1.07g/cm3 |
Schmelzpunkt |
102.5-107.5℃ |
Siedepunkt |
299.1°C at 760 mmHg |
Brechungsindex |
1.521 |
Flammpunkt |
134.7°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|