상품명칭 |
2-Ethylbenzeneboronic acid |
별명 |
2-Ethylphenylboronic acid; RNase A |
분자식 |
C8H11BO2 |
분자량 |
149.9827 |
InChI |
InChI=1/C8H11BO2/c1-2-7-5-3-4-6-8(7)9(10)11/h3-6,10-11H,2H2,1H3 |
cas번호 |
90002-36-1 |
분자 구조 |
|
밀도 |
1.07g/cm3 |
녹는 점 |
102.5-107.5℃ |
비등점 |
299.1°C at 760 mmHg |
굴절 지수 |
1.521 |
인화점 |
134.7°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|