Nome del prodotto |
2,3-Benzanthracene |
Sinonimi |
NAPHTHACENE; Chrysogen; LT-S940; Tetracene |
Formula molecolare |
C18H12 |
Peso Molecolare |
228.2879 |
InChI |
InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
Numero CAS |
92-24-0 |
EINECS |
202-138-9 |
Struttura molecolare |
|
Densità |
1.19g/cm3 |
Punto di fusione |
300℃ |
Punto di ebollizione |
436.7°C at 760 mmHg |
Indice di rifrazione |
1.771 |
Punto d'infiammabilità |
209.1°C |
Simboli di pericolo |
Xn:Harmful;
|
Codici di Rischio |
R40:Possible risks of irreversible effects.;
|
Sicurezza Descrizione |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|