Nazwa produktu: |
2,3-Benzanthracene |
Synonimy |
NAPHTHACENE; Chrysogen; LT-S940; Tetracene |
MF |
C18H12 |
Masie cząsteczkowej |
228.2879 |
InChI |
InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
Nr CAS |
92-24-0 |
EINECS |
202-138-9 |
Struktury molekularnej |
|
Gęstość |
1.19g/cm3 |
Temperatura topnienia |
300℃ |
Temperatura wrzenia |
436.7°C at 760 mmHg |
Współczynnik załamania |
1.771 |
Temperatura zapłonu |
209.1°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R40:Possible risks of irreversible effects.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|