produktnavn |
2,5-Dimethylcinnamic acid |
Synonymer |
(2E)-3-(2,5-dimethylphenyl)prop-2-enoic acid |
Molekylær Formel |
C11H12O2 |
Molekylvekt |
176.2118 |
InChI |
InChI=1/C11H12O2/c1-8-3-4-9(2)10(7-8)5-6-11(12)13/h3-7H,1-2H3,(H,12,13)/b6-5+ |
CAS-nummer |
95883-10-6 |
Molecular Structure |
|
Tetthet |
1.118g/cm3 |
Kokepunkt |
307°C at 760 mmHg |
Brytningsindeks |
1.592 |
Flammepunktet |
212.2°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|