2,5-Dimethylcinnamic acid

اسم المنتج	2,5-Dimethylcinnamic acid
الاسم المستعار	(2E)-3-(2,5-dimethylphenyl)prop-2-enoic acid
الصيغة الجزيئية	C₁₁H₁₂O₂
الوزن الجزيئي الغرامي	176.2118
InChI	InChI=1/C11H12O2/c1-8-3-4-9(2)10(7-8)5-6-11(12)13/h3-7H,1-2H3,(H,12,13)/b6-5+
إستراتيجية المساعدة القطرية	95883-10-6
بنية جزيئية
كثافة	1.118g/cm³
نقطة الغليان	307°C at 760 mmHg
معامل الإنكسار	1.592
نقطة الوميض	212.2°C
خطر المصطلحات	R36/37/38:Irritating to eyes, respiratory system and skin.;
شروط الأمن	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;