اسم المنتج |
2,5-Dimethylcinnamic acid |
الاسم المستعار |
(2E)-3-(2,5-dimethylphenyl)prop-2-enoic acid |
الصيغة الجزيئية |
C11H12O2 |
الوزن الجزيئي الغرامي |
176.2118 |
InChI |
InChI=1/C11H12O2/c1-8-3-4-9(2)10(7-8)5-6-11(12)13/h3-7H,1-2H3,(H,12,13)/b6-5+ |
إستراتيجية المساعدة القطرية |
95883-10-6 |
بنية جزيئية |
|
كثافة |
1.118g/cm3 |
نقطة الغليان |
307°C at 760 mmHg |
معامل الإنكسار |
1.592 |
نقطة الوميض |
212.2°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|