název výrobku |
3-Methyl-4-nitrobenzonitrile |
Synonyma |
4-Nitro-m-tolunitrile;
|
Molekulární vzorec |
C8H6N2O2 |
Molekulová hmotnost |
162.1454 |
InChI |
InChI=1/C8H6N2O2/c1-6-4-7(5-9)2-3-8(6)10(11)12/h2-4H,1H3 |
Registrační číslo CAS |
96784-54-2 |
Molekulární struktura |
|
Hustota |
1.26g/cm3 |
Bod tání |
82-83℃ |
Bod varu |
322.2°C at 760 mmHg |
Index lomu |
1.568 |
Bod vzplanutí |
148.6°C |
Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpečnostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|