Ονομασία του προϊόντος |
3-Methyl-4-nitrobenzonitrile |
Συνώνυμα |
4-Nitro-m-tolunitrile;
|
MF |
C8H6N2O2 |
Μοριακό βάρος |
162.1454 |
InChI |
InChI=1/C8H6N2O2/c1-6-4-7(5-9)2-3-8(6)10(11)12/h2-4H,1H3 |
CAS ΟΧΙ |
96784-54-2 |
Μοριακή δομή |
|
Πυκνότητα |
1.26g/cm3 |
Σημείο τήξης |
82-83℃ |
Σημείο βρασμού |
322.2°C at 760 mmHg |
Δείκτης διάθλασης |
1.568 |
Σημείο ανάφλεξης |
148.6°C |
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|