product Name |
di2-thienylmethanone oxime |
Synonyms |
Bis(2-thienyl) ketoxime; Di-2-thienylmethanone oxime; dithiophen-2-ylmethanone oxime |
Molecular Formula |
C9H7NOS2 |
Molecular Weight |
209.288 |
InChI |
InChI=1/C9H7NOS2/c11-10-9(7-3-1-5-12-7)8-4-2-6-13-8/h1-6,11H |
CAS Registry Number |
10558-44-8 |
Molecular Structure |
|
Density |
1.38g/cm3 |
Melting point |
125℃ |
Boiling point |
361.1°C at 760 mmHg |
Refractive index |
1.698 |
Flash point |
172.2°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|