اسم المنتج |
di2-thienylmethanone oxime |
الاسم المستعار |
Bis(2-thienyl) ketoxime; Di-2-thienylmethanone oxime; dithiophen-2-ylmethanone oxime |
الصيغة الجزيئية |
C9H7NOS2 |
الوزن الجزيئي الغرامي |
209.288 |
InChI |
InChI=1/C9H7NOS2/c11-10-9(7-3-1-5-12-7)8-4-2-6-13-8/h1-6,11H |
إستراتيجية المساعدة القطرية |
10558-44-8 |
بنية جزيئية |
|
كثافة |
1.38g/cm3 |
درجة الإنصهار |
125℃ |
نقطة الغليان |
361.1°C at 760 mmHg |
معامل الإنكسار |
1.698 |
نقطة الوميض |
172.2°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|