Nazwa produktu: |
di2-thienylmethanone oxime |
Synonimy |
Bis(2-thienyl) ketoxime; Di-2-thienylmethanone oxime; dithiophen-2-ylmethanone oxime |
MF |
C9H7NOS2 |
Masie cząsteczkowej |
209.288 |
InChI |
InChI=1/C9H7NOS2/c11-10-9(7-3-1-5-12-7)8-4-2-6-13-8/h1-6,11H |
Nr CAS |
10558-44-8 |
Struktury molekularnej |
|
Gęstość |
1.38g/cm3 |
Temperatura topnienia |
125℃ |
Temperatura wrzenia |
361.1°C at 760 mmHg |
Współczynnik załamania |
1.698 |
Temperatura zapłonu |
172.2°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|