उत्पाद का नाम |
2-Methoxyethyl acetate |
समानार्थी |
Methyl Cellosolve?acetate; 1-Acetoxy-2-methoxyethane; Ethylene glycol monomethyl ether acetate; Methyl Cellosolve(rg acetate; 2-sulfanylethyl acetate |
आणविक फार्मूला |
C4H8O2S |
आण्विक वजन |
120.1701 |
InChI |
InChI=1/C4H8O2S/c1-4(5)6-2-3-7/h7H,2-3H2,1H3 |
कैस रजिस्टी संख्या |
110-49-6 |
EINECS |
203-772-9 |
आणविक संरचना |
|
घनत्व |
1.072g/cm3 |
गलनांक |
-65℃ |
उबलने का समय |
162.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.452 |
फ्लैश प्वाइंट |
57.6°C |
खतरा प्रतीक |
T:Toxic;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R60:May impair fertility.;
R61:May cause harm to the unborn child.;
|
सुरक्षा विवरण |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|