상품명칭 |
2-Methoxyethyl acetate |
별명 |
Methyl Cellosolve?acetate; 1-Acetoxy-2-methoxyethane; Ethylene glycol monomethyl ether acetate; Methyl Cellosolve(rg acetate; 2-sulfanylethyl acetate |
분자식 |
C4H8O2S |
분자량 |
120.1701 |
InChI |
InChI=1/C4H8O2S/c1-4(5)6-2-3-7/h7H,2-3H2,1H3 |
cas번호 |
110-49-6 |
EC번호 |
203-772-9 |
분자 구조 |
|
밀도 |
1.072g/cm3 |
녹는 점 |
-65℃ |
비등점 |
162.7°C at 760 mmHg |
굴절 지수 |
1.452 |
인화점 |
57.6°C |
위험성 표시 |
T:Toxic;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R60:May impair fertility.;
R61:May cause harm to the unborn child.;
|
보안 규칙 |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|