Nazwa produktu: |
2-Methoxyethyl acetate |
Synonimy |
Methyl Cellosolve?acetate; 1-Acetoxy-2-methoxyethane; Ethylene glycol monomethyl ether acetate; Methyl Cellosolve(rg acetate; 2-sulfanylethyl acetate |
MF |
C4H8O2S |
Masie cząsteczkowej |
120.1701 |
InChI |
InChI=1/C4H8O2S/c1-4(5)6-2-3-7/h7H,2-3H2,1H3 |
Nr CAS |
110-49-6 |
EINECS |
203-772-9 |
Struktury molekularnej |
|
Gęstość |
1.072g/cm3 |
Temperatura topnienia |
-65℃ |
Temperatura wrzenia |
162.7°C at 760 mmHg |
Współczynnik załamania |
1.452 |
Temperatura zapłonu |
57.6°C |
Symbole zagrożenia |
T:Toxic;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R60:May impair fertility.;
R61:May cause harm to the unborn child.;
|
Bezpieczeństwo opis |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|