product Name |
4-Chloro-3-fluorobenzonitrile |
Synonyms |
BUTTPARK 45\01-08; 3-Fluoro-4-Chlorobenzonitrile; 4-chloro-3-fluorobenzontrile |
Molecular Formula |
C7H3ClFN |
Molecular Weight |
155.5568 |
InChI |
InChI=1/C7H3ClFN/c8-6-2-1-5(4-10)3-7(6)9/h1-3H |
CAS Registry Number |
110888-15-8 |
Molecular Structure |
|
Density |
1.33g/cm3 |
Melting point |
79-81°C |
Boiling point |
214°C at 760 mmHg |
Refractive index |
1.536 |
Flash point |
83.2°C |
Hazard Symbols |
T,Xi:;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|