نام محصول |
4-Chloro-3-fluorobenzonitrile |
مترادف |
BUTTPARK 45\01-08; 3-Fluoro-4-Chlorobenzonitrile; 4-chloro-3-fluorobenzontrile |
میدان مغناطیسی |
C7H3ClFN |
وزن مولکولی |
155.5568 |
InChI |
InChI=1/C7H3ClFN/c8-6-2-1-5(4-10)3-7(6)9/h1-3H |
شماره سیایاس |
110888-15-8 |
ساختار مولکولی |
|
تراکم |
1.33g/cm3 |
نقطه ذوب |
79-81°C |
نقطه غلیان |
214°C at 760 mmHg |
ضریب شکست |
1.536 |
نقطه اشتعال |
83.2°C |
خطر نمادها |
T,Xi:;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|