Nama produk |
4-Chloro-3-fluorobenzonitrile |
Sinonim |
BUTTPARK 45\01-08; 3-Fluoro-4-Chlorobenzonitrile; 4-chloro-3-fluorobenzontrile |
MF |
C7H3ClFN |
Berat Molekul |
155.5568 |
InChI |
InChI=1/C7H3ClFN/c8-6-2-1-5(4-10)3-7(6)9/h1-3H |
CAS NO |
110888-15-8 |
Struktur Molekul |
|
Kepadatan |
1.33g/cm3 |
Titik lebur |
79-81°C |
Titik didih |
214°C at 760 mmHg |
Indeks bias |
1.536 |
Titik nyala |
83.2°C |
Cinta bahaya |
T,Xi:;
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|