product Name |
2,2'-bithiophene-5-boronic acid |
Synonyms |
2,2'-bithiophen-5-ylboronic acid |
Molecular Formula |
C8H7BO2S2 |
Molecular Weight |
210.081 |
InChI |
InChI=1/C8H7BO2S2/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h1-5,10-11H |
CAS Registry Number |
132898-95-4 |
Molecular Structure |
|
Density |
1.42g/cm3 |
Melting point |
127℃ |
Boiling point |
416.1°C at 760 mmHg |
Refractive index |
1.658 |
Flash point |
205.5°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|