نام محصول |
2,2'-bithiophene-5-boronic acid |
مترادف |
2,2'-bithiophen-5-ylboronic acid |
میدان مغناطیسی |
C8H7BO2S2 |
وزن مولکولی |
210.081 |
InChI |
InChI=1/C8H7BO2S2/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h1-5,10-11H |
شماره سیایاس |
132898-95-4 |
ساختار مولکولی |
|
تراکم |
1.42g/cm3 |
نقطه ذوب |
127℃ |
نقطه غلیان |
416.1°C at 760 mmHg |
ضریب شکست |
1.658 |
نقطه اشتعال |
205.5°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|