Naam product |
2,2'-bithiophene-5-boronic acid |
Synoniemen |
2,2'-bithiophen-5-ylboronic acid |
MF |
C8H7BO2S2 |
Molecuulgewicht |
210.081 |
InChI |
InChI=1/C8H7BO2S2/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h1-5,10-11H |
CAS-nummer |
132898-95-4 |
Moleculaire Structuur |
|
Dichtheid |
1.42g/cm3 |
Smeltpunt |
127℃ |
Kookpunt |
416.1°C at 760 mmHg |
Brekingsindex |
1.658 |
Vlampunt |
205.5°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|