نام محصول |
2,5-Dichlorobenzeneboronic acid |
مترادف |
2,5-Dichlorophenylboronic acid |
میدان مغناطیسی |
C6H5BCl2O2 |
وزن مولکولی |
190.8197 |
InChI |
InChI=1/C6H5BCl2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H |
شماره سیایاس |
135145-90-3 |
ساختار مولکولی |
|
تراکم |
1.47g/cm3 |
نقطه ذوب |
150℃ |
نقطه غلیان |
343.6°C at 760 mmHg |
ضریب شکست |
1.577 |
نقطه اشتعال |
161.6°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|