Nome del prodotto |
2,5-Dichlorobenzeneboronic acid |
Sinonimi |
2,5-Dichlorophenylboronic acid |
Formula molecolare |
C6H5BCl2O2 |
Peso Molecolare |
190.8197 |
InChI |
InChI=1/C6H5BCl2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H |
Numero CAS |
135145-90-3 |
Struttura molecolare |
|
Densità |
1.47g/cm3 |
Punto di fusione |
150℃ |
Punto di ebollizione |
343.6°C at 760 mmHg |
Indice di rifrazione |
1.577 |
Punto d'infiammabilità |
161.6°C |
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|