اسم المنتج |
2,5-Dichlorobenzeneboronic acid |
الاسم المستعار |
2,5-Dichlorophenylboronic acid |
الصيغة الجزيئية |
C6H5BCl2O2 |
الوزن الجزيئي الغرامي |
190.8197 |
InChI |
InChI=1/C6H5BCl2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H |
إستراتيجية المساعدة القطرية |
135145-90-3 |
بنية جزيئية |
|
كثافة |
1.47g/cm3 |
درجة الإنصهار |
150℃ |
نقطة الغليان |
343.6°C at 760 mmHg |
معامل الإنكسار |
1.577 |
نقطة الوميض |
161.6°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|