Nama produk |
1-Bromo-2,5-difluoro-4-nitrobenzene |
Sinonim |
4-Bromo-2,5-difluoronitrobenzene |
MF |
C6H2BrF2NO2 |
Berat Molekul |
237.9864 |
InChI |
InChI=1/C6H2BrF2NO2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H |
CAS NO |
167415-27-2 |
Struktur Molekul |
|
Kepadatan |
1.89g/cm3 |
Titik didih |
262.4°C at 760 mmHg |
Indeks bias |
1.556 |
Titik nyala |
112.5°C |
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|