Nazwa produktu: |
1-Bromo-2,5-difluoro-4-nitrobenzene |
Synonimy |
4-Bromo-2,5-difluoronitrobenzene |
MF |
C6H2BrF2NO2 |
Masie cząsteczkowej |
237.9864 |
InChI |
InChI=1/C6H2BrF2NO2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H |
Nr CAS |
167415-27-2 |
Struktury molekularnej |
|
Gęstość |
1.89g/cm3 |
Temperatura wrzenia |
262.4°C at 760 mmHg |
Współczynnik załamania |
1.556 |
Temperatura zapłonu |
112.5°C |
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|