Ürün Adı |
1-Bromo-2,5-difluoro-4-nitrobenzene |
Eş anlamlı |
4-Bromo-2,5-difluoronitrobenzene |
Moleküler Formülü |
C6H2BrF2NO2 |
Molekül Ağırlığı |
237.9864 |
InChI |
InChI=1/C6H2BrF2NO2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H |
CAS kayıt numarası |
167415-27-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.89g/cm3 |
Kaynama noktası |
262.4°C at 760 mmHg |
Kırılma indisi |
1.556 |
Alevlenme noktası |
112.5°C |
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|