Produkt-Name |
2,3,4,5-Tetrafluorobenzeneboronic acid |
Synonyme |
2,3,4,5-Tetrafluorophenylboronic acid |
Molekulare Formel |
C6H3BF4O2 |
Molecular Weight |
193.8914 |
InChI |
InChI=1/C6H3BF4O2/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1,12-13H |
CAS Registry Number |
179923-32-1 |
Molecular Structure |
|
Dichte |
1.53g/cm3 |
Siedepunkt |
257.6°C at 760 mmHg |
Brechungsindex |
1.446 |
Flammpunkt |
109.6°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|