Naam product |
2,3,4,5-Tetrafluorobenzeneboronic acid |
Synoniemen |
2,3,4,5-Tetrafluorophenylboronic acid |
MF |
C6H3BF4O2 |
Molecuulgewicht |
193.8914 |
InChI |
InChI=1/C6H3BF4O2/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1,12-13H |
CAS-nummer |
179923-32-1 |
Moleculaire Structuur |
|
Dichtheid |
1.53g/cm3 |
Kookpunt |
257.6°C at 760 mmHg |
Brekingsindex |
1.446 |
Vlampunt |
109.6°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|