اسم المنتج |
2,3,4,5-Tetrafluorobenzeneboronic acid |
الاسم المستعار |
2,3,4,5-Tetrafluorophenylboronic acid |
الصيغة الجزيئية |
C6H3BF4O2 |
الوزن الجزيئي الغرامي |
193.8914 |
InChI |
InChI=1/C6H3BF4O2/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1,12-13H |
إستراتيجية المساعدة القطرية |
179923-32-1 |
بنية جزيئية |
|
كثافة |
1.53g/cm3 |
نقطة الغليان |
257.6°C at 760 mmHg |
معامل الإنكسار |
1.446 |
نقطة الوميض |
109.6°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|