product Name |
2,3-difluorobenzamide |
Synonyms |
2,3-Difluorobenzamide |
Molecular Formula |
C7H5F2NO |
Molecular Weight |
157.1175 |
InChI |
InChI=1/C7H5F2NO/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H2,10,11) |
CAS Registry Number |
18355-75-4 |
Molecular Structure |
|
Density |
1.348g/cm3 |
Boiling point |
197°C at 760 mmHg |
Refractive index |
1.515 |
Flash point |
73°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|