상품명칭 |
2,3-difluorobenzamide |
별명 |
2,3-Difluorobenzamide |
분자식 |
C7H5F2NO |
분자량 |
157.1175 |
InChI |
InChI=1/C7H5F2NO/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H2,10,11) |
cas번호 |
18355-75-4 |
분자 구조 |
|
밀도 |
1.348g/cm3 |
비등점 |
197°C at 760 mmHg |
굴절 지수 |
1.515 |
인화점 |
73°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|