Nome del prodotto |
2,3-difluorobenzamide |
Sinonimi |
2,3-Difluorobenzamide |
Formula molecolare |
C7H5F2NO |
Peso Molecolare |
157.1175 |
InChI |
InChI=1/C7H5F2NO/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H2,10,11) |
Numero CAS |
18355-75-4 |
Struttura molecolare |
|
Densità |
1.348g/cm3 |
Punto di ebollizione |
197°C at 760 mmHg |
Indice di rifrazione |
1.515 |
Punto d'infiammabilità |
73°C |
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|